C26H34N4O3 — CID 121063342
N-[2-[(4-tert-butylphenyl)carbamoylamino]ethyl]-4-(cyclopentanecarbonylamino)benzamide (PubChem CID 121063342) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[2-[(4-tert-butylphenyl)carbamoylamino]ethyl]-4-(cyclopentanecarbonylamino)benzamide.
| Compound Name | N-[2-[(4-tert-butylphenyl)carbamoylamino]ethyl]-4-(cyclopentanecarbonylamino)benzamide |
|---|---|
| PubChem CID | 121063342 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N-[2-[(4-tert-butylphenyl)carbamoylamino]ethyl]-4-(cyclopentanecarbonylamino)benzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCNC(=O)c2ccc(NC(=O)C3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O3/c1-26(2,3)20-10-14-22(15-11-20)30-25(33)28-17-16-27-23(31)19-8-12-21(13-9-19)29-24(32)18-6-4-5-7-18/h8-15,18H,4-7,16-17H2,1-3H3,(H,27,31)(H,29,32)(H2,28,30,33) |
| InChIKey | ZKMMPUGUGKYUGV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|