C12H12Cl2O3S — CID 113289654
2-(2,4-dichlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone (PubChem CID 113289654) has the molecular formula C12H12Cl2O3S and a molecular weight of 307.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone |
|---|---|
| PubChem CID | 113289654 |
| Molecular Formula | C12H12Cl2O3S |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12Cl2O3S/c13-10-2-1-8(11(14)6-10)5-12(15)9-3-4-18(16,17)7-9/h1-2,6,9H,3-5,7H2 |
| InChIKey | DETPIOVOFBYCMU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |