C12H13ClO3S — CID 64904345
2-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone (PubChem CID 64904345) has the molecular formula C12H13ClO3S and a molecular weight of 272.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone |
|---|---|
| PubChem CID | 64904345 |
| Molecular Formula | C12H13ClO3S |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13ClO3S/c13-11-3-1-9(2-4-11)7-12(14)10-5-6-17(15,16)8-10/h1-4,10H,5-8H2 |
| InChIKey | DLMOCNMHEIXSLX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |