C12H13IO3S — CID 115336298
1-(1,1-dioxothiolan-3-yl)-2-(4-iodophenyl)ethanone (PubChem CID 115336298) has the molecular formula C12H13IO3S and a molecular weight of 364.20 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-(4-iodophenyl)ethanone.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-(4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 115336298 |
| Molecular Formula | C12H13IO3S |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-(4-iodophenyl)ethanone |
| SMILES | O=C(Cc1ccc(I)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13IO3S/c13-11-3-1-9(2-4-11)7-12(14)10-5-6-17(15,16)8-10/h1-4,10H,5-8H2 |
| InChIKey | QDYDQTPZCOTBPU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|