C12H12ClFO3S — CID 107884081
2-(4-chloro-3-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone (PubChem CID 107884081) has the molecular formula C12H12ClFO3S and a molecular weight of 290.74 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone |
|---|---|
| PubChem CID | 107884081 |
| Molecular Formula | C12H12ClFO3S |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(F)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12ClFO3S/c13-10-2-1-8(5-11(10)14)6-12(15)9-3-4-18(16,17)7-9/h1-2,5,9H,3-4,6-7H2 |
| InChIKey | ZRUPXOQXMCPPHR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |