C17H22ClFO — CID 107883999
2-(4-chloro-3-fluorophenyl)-1-(4-propylcyclohexyl)ethanone (PubChem CID 107883999) has the molecular formula C17H22ClFO and a molecular weight of 296.81 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-(4-propylcyclohexyl)ethanone.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-(4-propylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 107883999 |
| Molecular Formula | C17H22ClFO |
| Molecular Weight | 296.81 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-(4-propylcyclohexyl)ethanone |
| SMILES | CCCC1CCC(C(=O)Cc2ccc(Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C17H22ClFO/c1-2-3-12-4-7-14(8-5-12)17(20)11-13-6-9-15(18)16(19)10-13/h6,9-10,12,14H,2-5,7-8,11H2,1H3 |
| InChIKey | PTJDBXBNBNRAMY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.81 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |