C18H25BrO2 — CID 65423096
2-(3-bromo-4-methoxyphenyl)-1-(4-propylcyclohexyl)ethanone (PubChem CID 65423096) has the molecular formula C18H25BrO2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-(4-propylcyclohexyl)ethanone.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-(4-propylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 65423096 |
| Molecular Formula | C18H25BrO2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-(4-propylcyclohexyl)ethanone |
| SMILES | CCCC1CCC(C(=O)Cc2ccc(OC)c(Br)c2)CC1 |
| InChI | InChI=1S/C18H25BrO2/c1-3-4-13-5-8-15(9-6-13)17(20)12-14-7-10-18(21-2)16(19)11-14/h7,10-11,13,15H,3-6,8-9,12H2,1-2H3 |
| InChIKey | MJZCKLOBORLYPT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |