C16H20BrNO2 — CID 116580920
1-(3-amino-2-bicyclo[2.2.1]heptanyl)-2-(3-bromo-4-methoxyphenyl)ethanone (PubChem CID 116580920) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is 1-(3-amino-2-bicyclo[2.2.1]heptanyl)-2-(3-bromo-4-methoxyphenyl)ethanone.
| Compound Name | 1-(3-amino-2-bicyclo[2.2.1]heptanyl)-2-(3-bromo-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 116580920 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-(3-amino-2-bicyclo[2.2.1]heptanyl)-2-(3-bromo-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)C2C3CCC(C3)C2N)cc1Br |
| InChI | InChI=1S/C16H20BrNO2/c1-20-14-5-2-9(6-12(14)17)7-13(19)15-10-3-4-11(8-10)16(15)18/h2,5-6,10-11,15-16H,3-4,7-8,18H2,1H3 |
| InChIKey | OXPLOPHPRIJLDJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |