C15H18ClNO — CID 116580665
1-(3-amino-2-bicyclo[2.2.1]heptanyl)-2-(4-chlorophenyl)ethanone (PubChem CID 116580665) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is 1-(3-amino-2-bicyclo[2.2.1]heptanyl)-2-(4-chlorophenyl)ethanone.
| Compound Name | 1-(3-amino-2-bicyclo[2.2.1]heptanyl)-2-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 116580665 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-(3-amino-2-bicyclo[2.2.1]heptanyl)-2-(4-chlorophenyl)ethanone |
| SMILES | NC1C2CCC(C2)C1C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClNO/c16-12-5-1-9(2-6-12)7-13(18)14-10-3-4-11(8-10)15(14)17/h1-2,5-6,10-11,14-15H,3-4,7-8,17H2 |
| InChIKey | ZYIDZRJUBNVFOD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |