C16H20Cl2O — CID 64773768
2-(3,4-dichlorophenyl)-1-(4-ethylcyclohexyl)ethanone (PubChem CID 64773768) has the molecular formula C16H20Cl2O and a molecular weight of 299.24 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(4-ethylcyclohexyl)ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(4-ethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 64773768 |
| Molecular Formula | C16H20Cl2O |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(4-ethylcyclohexyl)ethanone |
| SMILES | CCC1CCC(C(=O)Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H20Cl2O/c1-2-11-3-6-13(7-4-11)16(19)10-12-5-8-14(17)15(18)9-12/h5,8-9,11,13H,2-4,6-7,10H2,1H3 |
| InChIKey | FGGBVMBVDFHZCF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |