C15H19Cl2NO — CID 78786076
N-(cyclopropylmethyl)-2-(3,4-dichlorophenyl)-N-propylacetamide (PubChem CID 78786076) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(3,4-dichlorophenyl)-N-propylacetamide.
| Compound Name | N-(cyclopropylmethyl)-2-(3,4-dichlorophenyl)-N-propylacetamide |
|---|---|
| PubChem CID | 78786076 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(3,4-dichlorophenyl)-N-propylacetamide |
| SMILES | CCCN(CC1CC1)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO/c1-2-7-18(10-11-3-4-11)15(19)9-12-5-6-13(16)14(17)8-12/h5-6,8,11H,2-4,7,9-10H2,1H3 |
| InChIKey | CFWVXWVULIXHLU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |