C10H11Cl2NO — CID 14740023
2-(3,4-dichlorophenyl)-N,N-dimethylacetamide (PubChem CID 14740023) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N,N-dimethylacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 14740023 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO/c1-13(2)10(14)6-7-3-4-8(11)9(12)5-7/h3-5H,6H2,1-2H3 |
| InChIKey | HOKOAXARHUIVBG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |