2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid

C13H15Cl2NO3 — CID 60832402

IUPAC2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid
SMILESCC(C)N(CC(=O)O)C(=O)Cc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H15Cl2NO3/c1-8(2)16(7-13(18)19)12(17)6-9-3-4-10(14)11(15)5-9/h3-5,8H,6-7H2,1-2H3,(H,18,19)
InChIKeyJLBWGCYQNULESB-UHFFFAOYSA-N
MW304.17 g/mol
LogP2.86
Rot. Bonds5

About 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid

2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid (PubChem CID 60832402) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid.

Molecular Properties

Compound Name2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid
PubChem CID60832402
Molecular FormulaC13H15Cl2NO3
Molecular Weight304.17 g/mol
Exact Mass303.04
IUPAC Name2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid
SMILESCC(C)N(CC(=O)O)C(=O)Cc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H15Cl2NO3/c1-8(2)16(7-13(18)19)12(17)6-9-3-4-10(14)11(15)5-9/h3-5,8H,6-7H2,1-2H3,(H,18,19)
InChIKeyJLBWGCYQNULESB-UHFFFAOYSA-N
XLogP2.86
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.17
LogP ≤ 52.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid?
The IUPAC name of 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid (CID 60832402) is 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid.
What is the SMILES notation for 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid?
The canonical SMILES for 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid is CC(C)N(CC(=O)O)C(=O)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid?
The InChIKey is JLBWGCYQNULESB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2NO3/c1-8(2)16(7-13(18)19)12(17)6-9-3-4-10(14)11(15)5-9/h3-5,8H,6-7H2,1-2H3,(H,18,19).
What are the key properties of 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid?
2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid has a molecular weight of 304.17 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,4-dichlorophenyl)acetyl]-propan-2-ylamino]acetic acid is sourced from PubChem (CID 60832402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).