2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid

C16H23NO3 — CID 62553124

IUPAC2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid
SMILESCCC(C)N(CC(=O)O)C(=O)Cc1ccc(C)c(C)c1
InChIInChI=1S/C16H23NO3/c1-5-13(4)17(10-16(19)20)15(18)9-14-7-6-11(2)12(3)8-14/h6-8,13H,5,9-10H2,1-4H3,(H,19,20)
InChIKeyKGJFJHSDKNTJSB-UHFFFAOYSA-N
MW277.36 g/mol
LogP2.56
Rot. Bonds6

About 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid

2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid (PubChem CID 62553124) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid.

Molecular Properties

Compound Name2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid
PubChem CID62553124
Molecular FormulaC16H23NO3
Molecular Weight277.36 g/mol
Exact Mass277.17
IUPAC Name2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid
SMILESCCC(C)N(CC(=O)O)C(=O)Cc1ccc(C)c(C)c1
InChIInChI=1S/C16H23NO3/c1-5-13(4)17(10-16(19)20)15(18)9-14-7-6-11(2)12(3)8-14/h6-8,13H,5,9-10H2,1-4H3,(H,19,20)
InChIKeyKGJFJHSDKNTJSB-UHFFFAOYSA-N
XLogP2.56
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.36
LogP ≤ 52.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid?
The IUPAC name of 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid (CID 62553124) is 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid.
What is the SMILES notation for 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid?
The canonical SMILES for 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid is CCC(C)N(CC(=O)O)C(=O)Cc1ccc(C)c(C)c1.
What is the InChIKey of 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid?
The InChIKey is KGJFJHSDKNTJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-5-13(4)17(10-16(19)20)15(18)9-14-7-6-11(2)12(3)8-14/h6-8,13H,5,9-10H2,1-4H3,(H,19,20).
What are the key properties of 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid?
2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid has a molecular weight of 277.36 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butan-2-yl-[2-(3,4-dimethylphenyl)acetyl]amino]acetic acid is sourced from PubChem (CID 62553124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).