C16H24ClNO — CID 63390601
N-(3-chloropropyl)-2-(3,4-dimethylphenyl)-N-propan-2-ylacetamide (PubChem CID 63390601) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is N-(3-chloropropyl)-2-(3,4-dimethylphenyl)-N-propan-2-ylacetamide.
| Compound Name | N-(3-chloropropyl)-2-(3,4-dimethylphenyl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 63390601 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(3-chloropropyl)-2-(3,4-dimethylphenyl)-N-propan-2-ylacetamide |
| SMILES | Cc1ccc(CC(=O)N(CCCCl)C(C)C)cc1C |
| InChI | InChI=1S/C16H24ClNO/c1-12(2)18(9-5-8-17)16(19)11-15-7-6-13(3)14(4)10-15/h6-7,10,12H,5,8-9,11H2,1-4H3 |
| InChIKey | JQEVWTHGTDKWCR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|