C14H18BrF2NO — CID 80662378
N-(3-bromopropyl)-2-(3,4-difluorophenyl)-N-propan-2-ylacetamide (PubChem CID 80662378) has the molecular formula C14H18BrF2NO and a molecular weight of 334.20 g/mol. Its IUPAC name is N-(3-bromopropyl)-2-(3,4-difluorophenyl)-N-propan-2-ylacetamide.
| Compound Name | N-(3-bromopropyl)-2-(3,4-difluorophenyl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 80662378 |
| Molecular Formula | C14H18BrF2NO |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(3-bromopropyl)-2-(3,4-difluorophenyl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(CCCBr)C(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18BrF2NO/c1-10(2)18(7-3-6-15)14(19)9-11-4-5-12(16)13(17)8-11/h4-5,8,10H,3,6-7,9H2,1-2H3 |
| InChIKey | HECWTMROZDJNLW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|