C14H17IO — CID 65476464
2-(4-iodophenyl)-1-(3-methylcyclopentyl)ethanone (PubChem CID 65476464) has the molecular formula C14H17IO and a molecular weight of 328.19 g/mol. Its IUPAC name is 2-(4-iodophenyl)-1-(3-methylcyclopentyl)ethanone.
| Compound Name | 2-(4-iodophenyl)-1-(3-methylcyclopentyl)ethanone |
|---|---|
| PubChem CID | 65476464 |
| Molecular Formula | C14H17IO |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-(4-iodophenyl)-1-(3-methylcyclopentyl)ethanone |
| SMILES | CC1CCC(C(=O)Cc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C14H17IO/c1-10-2-5-12(8-10)14(16)9-11-3-6-13(15)7-4-11/h3-4,6-7,10,12H,2,5,8-9H2,1H3 |
| InChIKey | MUZWJHHHXSAQHU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|