C11H15NOS — CID 112642357
1-(3-methylcyclopentyl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 112642357) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(3-methylcyclopentyl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(3-methylcyclopentyl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 112642357 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-(3-methylcyclopentyl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | CC1CCC(C(=O)Cc2cncs2)C1 |
| InChI | InChI=1S/C11H15NOS/c1-8-2-3-9(4-8)11(13)5-10-6-12-7-14-10/h6-9H,2-5H2,1H3 |
| InChIKey | YYAAOYASYMYBDT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |