C9H12N2OS — CID 116568336
1-pyrrolidin-3-yl-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 116568336) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-pyrrolidin-3-yl-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-pyrrolidin-3-yl-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 116568336 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-pyrrolidin-3-yl-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)C1CCNC1 |
| InChI | InChI=1S/C9H12N2OS/c12-9(7-1-2-10-4-7)3-8-5-11-6-13-8/h5-7,10H,1-4H2 |
| InChIKey | DOIOSXKIQFFLRV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |