C11H16N2OS — CID 116579911
1-(2-aminocyclohexyl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 116579911) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-(2-aminocyclohexyl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(2-aminocyclohexyl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 116579911 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2-aminocyclohexyl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | NC1CCCCC1C(=O)Cc1cncs1 |
| InChI | InChI=1S/C11H16N2OS/c12-10-4-2-1-3-9(10)11(14)5-8-6-13-7-15-8/h6-7,9-10H,1-5,12H2 |
| InChIKey | JYTOLJKWYQASGX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |