C12H17NOS — CID 115796129
1-cyclohexyl-3-(1,3-thiazol-5-yl)propan-2-one (PubChem CID 115796129) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1,3-thiazol-5-yl)propan-2-one.
| Compound Name | 1-cyclohexyl-3-(1,3-thiazol-5-yl)propan-2-one |
|---|---|
| PubChem CID | 115796129 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-cyclohexyl-3-(1,3-thiazol-5-yl)propan-2-one |
| SMILES | O=C(Cc1cncs1)CC1CCCCC1 |
| InChI | InChI=1S/C12H17NOS/c14-11(7-12-8-13-9-15-12)6-10-4-2-1-3-5-10/h8-10H,1-7H2 |
| InChIKey | PWYMOZHAKMZKOU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |