C11H15NO2S — CID 115796077
4-(oxolan-2-yl)-1-(1,3-thiazol-5-yl)butan-2-one (PubChem CID 115796077) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-(oxolan-2-yl)-1-(1,3-thiazol-5-yl)butan-2-one.
| Compound Name | 4-(oxolan-2-yl)-1-(1,3-thiazol-5-yl)butan-2-one |
|---|---|
| PubChem CID | 115796077 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 4-(oxolan-2-yl)-1-(1,3-thiazol-5-yl)butan-2-one |
| SMILES | O=C(CCC1CCCO1)Cc1cncs1 |
| InChI | InChI=1S/C11H15NO2S/c13-9(6-11-7-12-8-15-11)3-4-10-2-1-5-14-10/h7-8,10H,1-6H2 |
| InChIKey | LULCDEJOXJTLER-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |