C12H17NO2S — CID 103457418
1-cyclohexyl-1-hydroxy-3-(1,3-thiazol-5-yl)propan-2-one (PubChem CID 103457418) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-cyclohexyl-1-hydroxy-3-(1,3-thiazol-5-yl)propan-2-one.
| Compound Name | 1-cyclohexyl-1-hydroxy-3-(1,3-thiazol-5-yl)propan-2-one |
|---|---|
| PubChem CID | 103457418 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 1-cyclohexyl-1-hydroxy-3-(1,3-thiazol-5-yl)propan-2-one |
| SMILES | O=C(Cc1cncs1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C12H17NO2S/c14-11(6-10-7-13-8-16-10)12(15)9-4-2-1-3-5-9/h7-9,12,15H,1-6H2 |
| InChIKey | FZHLPTGCZAEGNC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |