C10H16N2S — CID 82399288
1-cyclopentyl-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 82399288) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-cyclopentyl-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-cyclopentyl-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 82399288 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-cyclopentyl-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | NC(Cc1cncs1)C1CCCC1 |
| InChI | InChI=1S/C10H16N2S/c11-10(8-3-1-2-4-8)5-9-6-12-7-13-9/h6-8,10H,1-5,11H2 |
| InChIKey | LMYAZGUJJMYSTR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |