C10H17N3S — CID 71644176
2-N-(1,3-thiazol-5-ylmethyl)cyclohexane-1,2-diamine (PubChem CID 71644176) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-N-(1,3-thiazol-5-ylmethyl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-(1,3-thiazol-5-ylmethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 71644176 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-N-(1,3-thiazol-5-ylmethyl)cyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1NCc1cncs1 |
| InChI | InChI=1S/C10H17N3S/c11-9-3-1-2-4-10(9)13-6-8-5-12-7-14-8/h5,7,9-10,13H,1-4,6,11H2 |
| InChIKey | LHGLULYPUPRVBK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |