C11H17ClN2S — CID 112644380
1-(2-chlorocyclohexyl)-N-(1,3-thiazol-5-ylmethyl)methanamine (PubChem CID 112644380) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 1-(2-chlorocyclohexyl)-N-(1,3-thiazol-5-ylmethyl)methanamine.
| Compound Name | 1-(2-chlorocyclohexyl)-N-(1,3-thiazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 112644380 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(2-chlorocyclohexyl)-N-(1,3-thiazol-5-ylmethyl)methanamine |
| SMILES | ClC1CCCCC1CNCc1cncs1 |
| InChI | InChI=1S/C11H17ClN2S/c12-11-4-2-1-3-9(11)5-13-6-10-7-14-8-15-10/h7-9,11,13H,1-6H2 |
| InChIKey | HTPAUCVEYYGEKC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|