C12H16BrClN2 — CID 104811205
N-[(5-bromo-3-pyridinyl)methyl]-1-(2-chlorocyclopentyl)methanamine (PubChem CID 104811205) has the molecular formula C12H16BrClN2 and a molecular weight of 303.63 g/mol. Its IUPAC name is N-[(5-bromo-3-pyridinyl)methyl]-1-(2-chlorocyclopentyl)methanamine.
| Compound Name | N-[(5-bromo-3-pyridinyl)methyl]-1-(2-chlorocyclopentyl)methanamine |
|---|---|
| PubChem CID | 104811205 |
| Molecular Formula | C12H16BrClN2 |
| Molecular Weight | 303.63 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | N-[(5-bromo-3-pyridinyl)methyl]-1-(2-chlorocyclopentyl)methanamine |
| SMILES | ClC1CCCC1CNCc1cncc(Br)c1 |
| InChI | InChI=1S/C12H16BrClN2/c13-11-4-9(6-16-8-11)5-15-7-10-2-1-3-12(10)14/h4,6,8,10,12,15H,1-3,5,7H2 |
| InChIKey | GBWVCYFYFWMPHP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|