C11H18N2S — CID 115732788
2-ethyl-N-(1,3-thiazol-5-ylmethyl)cyclopentan-1-amine (PubChem CID 115732788) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 2-ethyl-N-(1,3-thiazol-5-ylmethyl)cyclopentan-1-amine.
| Compound Name | 2-ethyl-N-(1,3-thiazol-5-ylmethyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 115732788 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-ethyl-N-(1,3-thiazol-5-ylmethyl)cyclopentan-1-amine |
| SMILES | CCC1CCCC1NCc1cncs1 |
| InChI | InChI=1S/C11H18N2S/c1-2-9-4-3-5-11(9)13-7-10-6-12-8-14-10/h6,8-9,11,13H,2-5,7H2,1H3 |
| InChIKey | AJFVYJPMVNHVBY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |