C9H14N2OS — CID 130933670
(2R,3R)-2-methyl-N-(1,3-thiazol-5-ylmethyl)oxolan-3-amine (PubChem CID 130933670) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is (2R,3R)-2-methyl-N-(1,3-thiazol-5-ylmethyl)oxolan-3-amine.
| Compound Name | (2R,3R)-2-methyl-N-(1,3-thiazol-5-ylmethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 130933670 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (2R,3R)-2-methyl-N-(1,3-thiazol-5-ylmethyl)oxolan-3-amine |
| SMILES | C[C@H]1OCC[C@H]1NCc1cncs1 |
| InChI | InChI=1S/C9H14N2OS/c1-7-9(2-3-12-7)11-5-8-4-10-6-13-8/h4,6-7,9,11H,2-3,5H2,1H3/t7-,9-/m1/s1 |
| InChIKey | TWTGNKBRJOYNCE-VXNVDRBHSA-N |
| XLogP | 1.41 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |