C14H18Cl3N — CID 65318503
1-(2-chlorocyclohexyl)-N-[(2,5-dichlorophenyl)methyl]methanamine (PubChem CID 65318503) has the molecular formula C14H18Cl3N and a molecular weight of 306.66 g/mol. Its IUPAC name is 1-(2-chlorocyclohexyl)-N-[(2,5-dichlorophenyl)methyl]methanamine.
| Compound Name | 1-(2-chlorocyclohexyl)-N-[(2,5-dichlorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 65318503 |
| Molecular Formula | C14H18Cl3N |
| Molecular Weight | 306.66 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-(2-chlorocyclohexyl)-N-[(2,5-dichlorophenyl)methyl]methanamine |
| SMILES | Clc1ccc(Cl)c(CNCC2CCCCC2Cl)c1 |
| InChI | InChI=1S/C14H18Cl3N/c15-12-5-6-14(17)11(7-12)9-18-8-10-3-1-2-4-13(10)16/h5-7,10,13,18H,1-4,8-9H2 |
| InChIKey | QZNOOSCMEZVTCV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|