C13H17Cl2N — CID 43317354
1-cyclopentyl-N-[(2,4-dichlorophenyl)methyl]methanamine (PubChem CID 43317354) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(2,4-dichlorophenyl)methyl]methanamine.
| Compound Name | 1-cyclopentyl-N-[(2,4-dichlorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 43317354 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-cyclopentyl-N-[(2,4-dichlorophenyl)methyl]methanamine |
| SMILES | Clc1ccc(CNCC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N/c14-12-6-5-11(13(15)7-12)9-16-8-10-3-1-2-4-10/h5-7,10,16H,1-4,8-9H2 |
| InChIKey | YJLMMNZAMXNVIA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |