C12H16ClN — CID 104853922
N-[(4-chloro-2-methylphenyl)methyl]-1-cyclopropylmethanamine (PubChem CID 104853922) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is N-[(4-chloro-2-methylphenyl)methyl]-1-cyclopropylmethanamine.
| Compound Name | N-[(4-chloro-2-methylphenyl)methyl]-1-cyclopropylmethanamine |
|---|---|
| PubChem CID | 104853922 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-[(4-chloro-2-methylphenyl)methyl]-1-cyclopropylmethanamine |
| SMILES | Cc1cc(Cl)ccc1CNCC1CC1 |
| InChI | InChI=1S/C12H16ClN/c1-9-6-12(13)5-4-11(9)8-14-7-10-2-3-10/h4-6,10,14H,2-3,7-8H2,1H3 |
| InChIKey | INZDZIPTHKLIOE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |