C12H14ClN — CID 104854390
N-[(4-chloro-2-methylphenyl)methyl]but-2-yn-1-amine (PubChem CID 104854390) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is N-[(4-chloro-2-methylphenyl)methyl]but-2-yn-1-amine.
| Compound Name | N-[(4-chloro-2-methylphenyl)methyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 104854390 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-[(4-chloro-2-methylphenyl)methyl]but-2-yn-1-amine |
| SMILES | CC#CCNCc1ccc(Cl)cc1C |
| InChI | InChI=1S/C12H14ClN/c1-3-4-7-14-9-11-5-6-12(13)8-10(11)2/h5-6,8,14H,7,9H2,1-2H3 |
| InChIKey | BMHBJLPPWFAXOG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|