C9H10ClNO2 — CID 68522575
(4-chloro-2-methylphenyl)methylcarbamic acid (PubChem CID 68522575) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl)methylcarbamic acid.
| Compound Name | (4-chloro-2-methylphenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 68522575 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (4-chloro-2-methylphenyl)methylcarbamic acid |
| SMILES | Cc1cc(Cl)ccc1CNC(=O)O |
| InChI | InChI=1S/C9H10ClNO2/c1-6-4-8(10)3-2-7(6)5-11-9(12)13/h2-4,11H,5H2,1H3,(H,12,13) |
| InChIKey | RZVSPDLJUREUTQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |