C17H17Cl2NO — CID 100708024
N-[(2,4-dichlorophenyl)methyl]-2,4,5-trimethylbenzamide (PubChem CID 100708024) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2,4,5-trimethylbenzamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2,4,5-trimethylbenzamide |
|---|---|
| PubChem CID | 100708024 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2,4,5-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NCc2ccc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C17H17Cl2NO/c1-10-6-12(3)15(7-11(10)2)17(21)20-9-13-4-5-14(18)8-16(13)19/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | POFORDCMPWNBDA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |