C11H16ClNO2 — CID 104854266
2-[(4-chloro-2-methylphenyl)methylamino]propane-1,3-diol (PubChem CID 104854266) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-[(4-chloro-2-methylphenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(4-chloro-2-methylphenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 104854266 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(4-chloro-2-methylphenyl)methylamino]propane-1,3-diol |
| SMILES | Cc1cc(Cl)ccc1CNC(CO)CO |
| InChI | InChI=1S/C11H16ClNO2/c1-8-4-10(12)3-2-9(8)5-13-11(6-14)7-15/h2-4,11,13-15H,5-7H2,1H3 |
| InChIKey | WRIKHDHWRVYRRV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |