C14H22ClNO — CID 104854271
3-[(4-chloro-2-methylphenyl)methylamino]-4-methylpentan-1-ol (PubChem CID 104854271) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 3-[(4-chloro-2-methylphenyl)methylamino]-4-methylpentan-1-ol.
| Compound Name | 3-[(4-chloro-2-methylphenyl)methylamino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 104854271 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-[(4-chloro-2-methylphenyl)methylamino]-4-methylpentan-1-ol |
| SMILES | Cc1cc(Cl)ccc1CNC(CCO)C(C)C |
| InChI | InChI=1S/C14H22ClNO/c1-10(2)14(6-7-17)16-9-12-4-5-13(15)8-11(12)3/h4-5,8,10,14,16-17H,6-7,9H2,1-3H3 |
| InChIKey | ZQIGRKVJNPSAQT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |