C11H15BrClNO — CID 103854651
(3R)-3-[(2-bromo-4-chlorophenyl)methylamino]butan-1-ol (PubChem CID 103854651) has the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. Its IUPAC name is (3R)-3-[(2-bromo-4-chlorophenyl)methylamino]butan-1-ol.
| Compound Name | (3R)-3-[(2-bromo-4-chlorophenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 103854651 |
| Molecular Formula | C11H15BrClNO |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | (3R)-3-[(2-bromo-4-chlorophenyl)methylamino]butan-1-ol |
| SMILES | C[C@H](CCO)NCc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C11H15BrClNO/c1-8(4-5-15)14-7-9-2-3-10(13)6-11(9)12/h2-3,6,8,14-15H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | BOMAJYQIUAPOPO-MRVPVSSYSA-N |
| XLogP | 2.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |