C9H11BrClN — CID 81497013
N-[(2-bromo-4-chlorophenyl)methyl]ethanamine (PubChem CID 81497013) has the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. Its IUPAC name is N-[(2-bromo-4-chlorophenyl)methyl]ethanamine.
| Compound Name | N-[(2-bromo-4-chlorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81497013 |
| Molecular Formula | C9H11BrClN |
| Molecular Weight | 248.55 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | N-[(2-bromo-4-chlorophenyl)methyl]ethanamine |
| SMILES | CCNCc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C9H11BrClN/c1-2-12-6-7-3-4-8(11)5-9(7)10/h3-5,12H,2,6H2,1H3 |
| InChIKey | JPUJFTNQLSSGKU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |