C11H16BrClN2 — CID 81495683
N-[(2-bromo-4-chlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 81495683) has the molecular formula C11H16BrClN2 and a molecular weight of 291.62 g/mol. Its IUPAC name is N-[(2-bromo-4-chlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(2-bromo-4-chlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 81495683 |
| Molecular Formula | C11H16BrClN2 |
| Molecular Weight | 291.62 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | N-[(2-bromo-4-chlorophenyl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C11H16BrClN2/c1-15(2)6-5-14-8-9-3-4-10(13)7-11(9)12/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | FULHLPMUARGOIO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|