C19H22BrClN2 — CID 145271670
N-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]phenyl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 145271670) has the molecular formula C19H22BrClN2 and a molecular weight of 393.76 g/mol. Its IUPAC name is N-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]phenyl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]phenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 145271670 |
| Molecular Formula | C19H22BrClN2 |
| Molecular Weight | 393.76 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]phenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1cccc(/C=C/c2ccc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C19H22BrClN2/c1-23(2)11-10-22-14-16-5-3-4-15(12-16)6-7-17-8-9-18(21)13-19(17)20/h3-9,12-13,22H,10-11,14H2,1-2H3/b7-6+ |
| InChIKey | HXVUVGZAUJSAQG-VOTSOKGWSA-N |
| XLogP | 4.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.76 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|