C22H24ClN3O5 — CID 69412297
but-2-enedioic acid;4-chloro-2-[3-[[2-(dimethylamino)ethylamino]methyl]phenoxy]benzonitrile (PubChem CID 69412297) has the molecular formula C22H24ClN3O5 and a molecular weight of 445.90 g/mol. Its IUPAC name is but-2-enedioic acid;4-chloro-2-[3-[[2-(dimethylamino)ethylamino]methyl]phenoxy]benzonitrile.
| Compound Name | but-2-enedioic acid;4-chloro-2-[3-[[2-(dimethylamino)ethylamino]methyl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 69412297 |
| Molecular Formula | C22H24ClN3O5 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | but-2-enedioic acid;4-chloro-2-[3-[[2-(dimethylamino)ethylamino]methyl]phenoxy]benzonitrile |
| SMILES | CN(C)CCNCc1cccc(Oc2cc(Cl)ccc2C#N)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H20ClN3O.C4H4O4/c1-22(2)9-8-21-13-14-4-3-5-17(10-14)23-18-11-16(19)7-6-15(18)12-20;5-3(6)1-2-4(7)8/h3-7,10-11,21H,8-9,13H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | QCFPQOKZLIEAKR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|