C25H29ClN2O2 — CID 44534297
3-[4-[[[3-(4-chlorophenoxy)phenyl]methylamino]methyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 44534297) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is 3-[4-[[[3-(4-chlorophenoxy)phenyl]methylamino]methyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-[[[3-(4-chlorophenoxy)phenyl]methylamino]methyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 44534297 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-[4-[[[3-(4-chlorophenoxy)phenyl]methylamino]methyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ccc(CNCc2cccc(Oc3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C25H29ClN2O2/c1-28(2)15-4-16-29-23-11-7-20(8-12-23)18-27-19-21-5-3-6-25(17-21)30-24-13-9-22(26)10-14-24/h3,5-14,17,27H,4,15-16,18-19H2,1-2H3 |
| InChIKey | FQCFMFOVSZIUHD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|