C36H34Cl2N4O6 — CID 131725985
bis(2-[3-(aminomethyl)-2-ethylphenoxy]-4-chlorobenzonitrile);(E)-but-2-enedioic acid (PubChem CID 131725985) has the molecular formula C36H34Cl2N4O6 and a molecular weight of 689.60 g/mol. Its IUPAC name is bis(2-[3-(aminomethyl)-2-ethylphenoxy]-4-chlorobenzonitrile);(E)-but-2-enedioic acid.
| Compound Name | bis(2-[3-(aminomethyl)-2-ethylphenoxy]-4-chlorobenzonitrile);(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 131725985 |
| Molecular Formula | C36H34Cl2N4O6 |
| Molecular Weight | 689.60 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | bis(2-[3-(aminomethyl)-2-ethylphenoxy]-4-chlorobenzonitrile);(E)-but-2-enedioic acid |
| SMILES | CCc1c(CN)cccc1Oc1cc(Cl)ccc1C#N.CCc1c(CN)cccc1Oc1cc(Cl)ccc1C#N.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C16H15ClN2O.C4H4O4/c2*1-2-14-11(9-18)4-3-5-15(14)20-16-8-13(17)7-6-12(16)10-19;5-3(6)1-2-4(7)8/h2*3-8H,2,9,18H2,1H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | OMDIUKXXXQLXFJ-WXXKFALUSA-N |
| XLogP | 7.76 |
| TPSA | 192.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.60 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|