C25H27N3O10 — CID 69411459
bis((E)-but-2-enedioic acid);6-ethyl-2-[2-methoxy-3-(methylaminomethyl)phenoxy]pyridine-3-carbonitrile (PubChem CID 69411459) has the molecular formula C25H27N3O10 and a molecular weight of 529.50 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);6-ethyl-2-[2-methoxy-3-(methylaminomethyl)phenoxy]pyridine-3-carbonitrile.
| Compound Name | bis((E)-but-2-enedioic acid);6-ethyl-2-[2-methoxy-3-(methylaminomethyl)phenoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 69411459 |
| Molecular Formula | C25H27N3O10 |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | bis((E)-but-2-enedioic acid);6-ethyl-2-[2-methoxy-3-(methylaminomethyl)phenoxy]pyridine-3-carbonitrile |
| SMILES | CCc1ccc(C#N)c(Oc2cccc(CNC)c2OC)n1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H19N3O2.2C4H4O4/c1-4-14-9-8-12(10-18)17(20-14)22-15-7-5-6-13(11-19-2)16(15)21-3;2*5-3(6)1-2-4(7)8/h5-9,19H,4,11H2,1-3H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | XRLFUQAXUWTGQB-LVEZLNDCSA-N |
| XLogP | 2.46 |
| TPSA | 216.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|