C24H29BrClN3O — CID 135174217
N-(azetidin-3-ylmethyl)-N'-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]ethane-1,2-diamine (PubChem CID 135174217) has the molecular formula C24H29BrClN3O and a molecular weight of 490.87 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-N'-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]ethane-1,2-diamine.
| Compound Name | N-(azetidin-3-ylmethyl)-N'-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 135174217 |
| Molecular Formula | C24H29BrClN3O |
| Molecular Weight | 490.87 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-N'-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]ethane-1,2-diamine |
| SMILES | C=CCOc1cc(/C=C/c2ccc(Cl)cc2Br)cc(CNCCNCC2CNC2)c1 |
| InChI | InChI=1S/C24H29BrClN3O/c1-2-9-30-23-11-18(3-4-21-5-6-22(26)13-24(21)25)10-19(12-23)14-27-7-8-28-15-20-16-29-17-20/h2-6,10-13,20,27-29H,1,7-9,14-17H2/b4-3+ |
| InChIKey | GYLLHRGOYIXFPK-ONEGZZNKSA-N |
| XLogP | 4.74 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|