C22H25FN2O — CID 135164785
1-(azetidin-3-yl)-N-[[3-[(E)-2-(4-fluorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]methanamine (PubChem CID 135164785) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N-[[3-[(E)-2-(4-fluorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]methanamine.
| Compound Name | 1-(azetidin-3-yl)-N-[[3-[(E)-2-(4-fluorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]methanamine |
|---|---|
| PubChem CID | 135164785 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-(azetidin-3-yl)-N-[[3-[(E)-2-(4-fluorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]methanamine |
| SMILES | C=CCOc1cc(/C=C/c2ccc(F)cc2)cc(CNCC2CNC2)c1 |
| InChI | InChI=1S/C22H25FN2O/c1-2-9-26-22-11-18(4-3-17-5-7-21(23)8-6-17)10-19(12-22)13-24-14-20-15-25-16-20/h2-8,10-12,20,24-25H,1,9,13-16H2/b4-3+ |
| InChIKey | SUUBDCAXJFMTPV-ONEGZZNKSA-N |
| XLogP | 3.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|