C24H32N2O3 — CID 135174140
1-(azetidin-3-yl)-N-[[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-prop-2-enoxyphenyl]methyl]methanamine (PubChem CID 135174140) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N-[[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-prop-2-enoxyphenyl]methyl]methanamine.
| Compound Name | 1-(azetidin-3-yl)-N-[[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-prop-2-enoxyphenyl]methyl]methanamine |
|---|---|
| PubChem CID | 135174140 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-(azetidin-3-yl)-N-[[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-prop-2-enoxyphenyl]methyl]methanamine |
| SMILES | C=CCOc1cc(CCc2ccc(OC)c(OC)c2)cc(CNCC2CNC2)c1 |
| InChI | InChI=1S/C24H32N2O3/c1-4-9-29-22-11-19(10-20(12-22)14-25-15-21-16-26-17-21)6-5-18-7-8-23(27-2)24(13-18)28-3/h4,7-8,10-13,21,25-26H,1,5-6,9,14-17H2,2-3H3 |
| InChIKey | FGFNNLDVNDYFKO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|