C28H26O2 — CID 89211050
1,4-bis[2-(4-prop-2-enoxyphenyl)ethenyl]benzene (PubChem CID 89211050) has the molecular formula C28H26O2 and a molecular weight of 394.51 g/mol. Its IUPAC name is 1,4-bis[2-(4-prop-2-enoxyphenyl)ethenyl]benzene.
| Compound Name | 1,4-bis[2-(4-prop-2-enoxyphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 89211050 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1,4-bis[2-(4-prop-2-enoxyphenyl)ethenyl]benzene |
| SMILES | C=CCOc1ccc(C=Cc2ccc(C=Cc3ccc(OCC=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H26O2/c1-3-21-29-27-17-13-25(14-18-27)11-9-23-5-7-24(8-6-23)10-12-26-15-19-28(20-16-26)30-22-4-2/h3-20H,1-2,21-22H2 |
| InChIKey | RWGPJTSAVVRMMA-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|