C24H27BrClN3O2 — CID 135174197
2-(azetidin-3-ylmethylamino)-N-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]acetamide (PubChem CID 135174197) has the molecular formula C24H27BrClN3O2 and a molecular weight of 504.86 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethylamino)-N-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]acetamide.
| Compound Name | 2-(azetidin-3-ylmethylamino)-N-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 135174197 |
| Molecular Formula | C24H27BrClN3O2 |
| Molecular Weight | 504.86 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 2-(azetidin-3-ylmethylamino)-N-[[3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxyphenyl]methyl]acetamide |
| SMILES | C=CCOc1cc(/C=C/c2ccc(Cl)cc2Br)cc(CNC(=O)CNCC2CNC2)c1 |
| InChI | InChI=1S/C24H27BrClN3O2/c1-2-7-31-22-9-17(3-4-20-5-6-21(26)11-23(20)25)8-18(10-22)15-29-24(30)16-28-14-19-12-27-13-19/h2-6,8-11,19,27-28H,1,7,12-16H2,(H,29,30)/b4-3+ |
| InChIKey | OZAYFUUGTGYTMG-ONEGZZNKSA-N |
| XLogP | 4.26 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|